C20H21BN2O3 — CID 164716813
2-[2-pyridin-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-yl]pyridine (PubChem CID 164716813) has the molecular formula C20H21BN2O3 and a molecular weight of 348.21 g/mol. Its IUPAC name is 2-[2-pyridin-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-yl]pyridine.
| Compound Name | 2-[2-pyridin-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-yl]pyridine |
|---|---|
| PubChem CID | 164716813 |
| Molecular Formula | C20H21BN2O3 |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2-[2-pyridin-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-yl]pyridine |
| SMILES | CC1(C)OB(c2cc(-c3ccccn3)c(-c3ccccn3)o2)OC1(C)C |
| InChI | InChI=1S/C20H21BN2O3/c1-19(2)20(3,4)26-21(25-19)17-13-14(15-9-5-7-11-22-15)18(24-17)16-10-6-8-12-23-16/h5-13H,1-4H3 |
| InChIKey | SXTSTLWODKHRJE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|