C22H30BNO2 — CID 90735136
2-[2-(2,2-dimethylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine (PubChem CID 90735136) has the molecular formula C22H30BNO2 and a molecular weight of 351.30 g/mol. Its IUPAC name is 2-[2-(2,2-dimethylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine.
| Compound Name | 2-[2-(2,2-dimethylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 90735136 |
| Molecular Formula | C22H30BNO2 |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 2-[2-(2,2-dimethylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
| SMILES | CC(C)(C)Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1-c1ccccn1 |
| InChI | InChI=1S/C22H30BNO2/c1-20(2,3)15-16-11-12-17(14-18(16)19-10-8-9-13-24-19)23-25-21(4,5)22(6,7)26-23/h8-14H,15H2,1-7H3 |
| InChIKey | KLFJJTICNHQRJK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|