C18H21BN2O3 — CID 141481952
2-pyridin-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 141481952) has the molecular formula C18H21BN2O3 and a molecular weight of 324.19 g/mol. Its IUPAC name is 2-pyridin-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | 2-pyridin-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 141481952 |
| Molecular Formula | C18H21BN2O3 |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-pyridin-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | CC1(C)OB(c2ccc(C(N)=O)c(-c3ccccn3)c2)OC1(C)C |
| InChI | InChI=1S/C18H21BN2O3/c1-17(2)18(3,4)24-19(23-17)12-8-9-13(16(20)22)14(11-12)15-7-5-6-10-21-15/h5-11H,1-4H3,(H2,20,22) |
| InChIKey | NRJFUJDRXIVMRK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|