C16H22BNO6 — CID 68673730
methyl 2-[2-carbamoyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate (PubChem CID 68673730) has the molecular formula C16H22BNO6 and a molecular weight of 335.17 g/mol. Its IUPAC name is methyl 2-[2-carbamoyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate.
| Compound Name | methyl 2-[2-carbamoyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 68673730 |
| Molecular Formula | C16H22BNO6 |
| Molecular Weight | 335.17 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | methyl 2-[2-carbamoyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(B2OC(C)(C)C(C)(C)O2)cc1C(N)=O |
| InChI | InChI=1S/C16H22BNO6/c1-15(2)16(3,4)24-17(23-15)10-6-7-12(11(8-10)14(18)20)22-9-13(19)21-5/h6-8H,9H2,1-5H3,(H2,18,20) |
| InChIKey | VYAXAZBGKJGWNB-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.17 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|