C16H24BNO4 — CID 140797231
methyl 2-(methylaminomethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 140797231) has the molecular formula C16H24BNO4 and a molecular weight of 305.18 g/mol. Its IUPAC name is methyl 2-(methylaminomethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | methyl 2-(methylaminomethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 140797231 |
| Molecular Formula | C16H24BNO4 |
| Molecular Weight | 305.18 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | methyl 2-(methylaminomethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | CNCc1ccc(B2OC(C)(C)C(C)(C)O2)cc1C(=O)OC |
| InChI | InChI=1S/C16H24BNO4/c1-15(2)16(3,4)22-17(21-15)12-8-7-11(10-18-5)13(9-12)14(19)20-6/h7-9,18H,10H2,1-6H3 |
| InChIKey | KRDKJMOKDYDUAX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.18 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|