C20H24BNO4 — CID 11428145
methyl 2-amino-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate (PubChem CID 11428145) has the molecular formula C20H24BNO4 and a molecular weight of 353.23 g/mol. Its IUPAC name is methyl 2-amino-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate.
| Compound Name | methyl 2-amino-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate |
|---|---|
| PubChem CID | 11428145 |
| Molecular Formula | C20H24BNO4 |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | methyl 2-amino-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate |
| SMILES | COC(=O)c1cc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)ccc1N |
| InChI | InChI=1S/C20H24BNO4/c1-19(2)20(3,4)26-21(25-19)15-9-6-13(7-10-15)14-8-11-17(22)16(12-14)18(23)24-5/h6-12H,22H2,1-5H3 |
| InChIKey | VWORDYWQNKMTLY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|