About 2-amino-5-phenylbenzoic acid;methyl 2-amino-5-phenylbenzoate
2-amino-5-phenylbenzoic acid;methyl 2-amino-5-phenylbenzoate (PubChem CID 159000318) has the molecular formula C27H24N2O4
and a molecular weight of 440.50 g/mol. Its IUPAC name is 2-amino-5-phenylbenzoic acid;methyl 2-amino-5-phenylbenzoate.
Molecular Properties
| Compound Name | 2-amino-5-phenylbenzoic acid;methyl 2-amino-5-phenylbenzoate |
| PubChem CID | 159000318 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 2-amino-5-phenylbenzoic acid;methyl 2-amino-5-phenylbenzoate |
| SMILES | COC(=O)c1cc(-c2ccccc2)ccc1N.Nc1ccc(-c2ccccc2)cc1C(=O)O |
| InChI | InChI=1S/C14H13NO2.C13H11NO2/c1-17-14(16)12-9-11(7-8-13(12)15)10-5-3-2-4-6-10;14-12-7-6-10(8-11(12)13(15)16)9-4-2-1-3-5-9/h2-9H,15H2,1H3;1-8H,14H2,(H,15,16) |
| InChIKey | JRGMBYVYSCNDBL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-phenylbenzoic acid;methyl 2-amino-5-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-phenylbenzoic acid;methyl 2-amino-5-phenylbenzoate?
The IUPAC name of 2-amino-5-phenylbenzoic acid;methyl 2-amino-5-phenylbenzoate (CID 159000318) is 2-amino-5-phenylbenzoic acid;methyl 2-amino-5-phenylbenzoate.
What is the SMILES notation for 2-amino-5-phenylbenzoic acid;methyl 2-amino-5-phenylbenzoate?
The canonical SMILES for 2-amino-5-phenylbenzoic acid;methyl 2-amino-5-phenylbenzoate is COC(=O)c1cc(-c2ccccc2)ccc1N.Nc1ccc(-c2ccccc2)cc1C(=O)O.
What is the InChIKey of 2-amino-5-phenylbenzoic acid;methyl 2-amino-5-phenylbenzoate?
The InChIKey is JRGMBYVYSCNDBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2.C13H11NO2/c1-17-14(16)12-9-11(7-8-13(12)15)10-5-3-2-4-6-10;14-12-7-6-10(8-11(12)13(15)16)9-4-2-1-3-5-9/h2-9H,15H2,1H3;1-8H,14H2,(H,15,16).
What are the key properties of 2-amino-5-phenylbenzoic acid;methyl 2-amino-5-phenylbenzoate?
2-amino-5-phenylbenzoic acid;methyl 2-amino-5-phenylbenzoate has a molecular weight of 440.50 g/mol, XLogP of 5.36, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-phenylbenzoic acid;methyl 2-amino-5-phenylbenzoate is sourced from PubChem (CID 159000318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).