About methyl 2-amino-4-phenylbenzoate
methyl 2-amino-4-phenylbenzoate (PubChem CID 53412316) has the molecular formula C14H13NO2
and a molecular weight of 227.26 g/mol. Its IUPAC name is methyl 2-amino-4-phenylbenzoate.
Molecular Properties
| Compound Name | methyl 2-amino-4-phenylbenzoate |
| PubChem CID | 53412316 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | methyl 2-amino-4-phenylbenzoate |
| SMILES | COC(=O)c1ccc(-c2ccccc2)cc1N |
| InChI | InChI=1S/C14H13NO2/c1-17-14(16)12-8-7-11(9-13(12)15)10-5-3-2-4-6-10/h2-9H,15H2,1H3 |
| InChIKey | VFGHBOADZPXLKY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-amino-4-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-4-phenylbenzoate?
The IUPAC name of methyl 2-amino-4-phenylbenzoate (CID 53412316) is methyl 2-amino-4-phenylbenzoate.
What is the SMILES notation for methyl 2-amino-4-phenylbenzoate?
The canonical SMILES for methyl 2-amino-4-phenylbenzoate is COC(=O)c1ccc(-c2ccccc2)cc1N.
What is the InChIKey of methyl 2-amino-4-phenylbenzoate?
The InChIKey is VFGHBOADZPXLKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2/c1-17-14(16)12-8-7-11(9-13(12)15)10-5-3-2-4-6-10/h2-9H,15H2,1H3.
What are the key properties of methyl 2-amino-4-phenylbenzoate?
methyl 2-amino-4-phenylbenzoate has a molecular weight of 227.26 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-4-phenylbenzoate is sourced from PubChem (CID 53412316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).