C37H38B2O4 — CID 153294242
4,4,5,5-tetramethyl-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,9'-spirobi[fluorene]-3-yl]-1,3,2-dioxaborolane (PubChem CID 153294242) has the molecular formula C37H38B2O4 and a molecular weight of 568.33 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,9'-spirobi[fluorene]-3-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,9'-spirobi[fluorene]-3-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 153294242 |
| Molecular Formula | C37H38B2O4 |
| Molecular Weight | 568.33 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,9'-spirobi[fluorene]-3-yl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc3c(c2)-c2cc(B4OC(C)(C)C(C)(C)O4)ccc2C32c3ccccc3-c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C37H38B2O4/c1-33(2)34(3,4)41-38(40-33)23-17-19-31-27(21-23)28-22-24(39-42-35(5,6)36(7,8)43-39)18-20-32(28)37(31)29-15-11-9-13-25(29)26-14-10-12-16-30(26)37/h9-22H,1-8H3 |
| InChIKey | NMXZZZBTZUBIJQ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.33 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|