C33H25BN2O2 — CID 171832539
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,9'-spirobi[fluorene]-2',7'-dicarbonitrile (PubChem CID 171832539) has the molecular formula C33H25BN2O2 and a molecular weight of 492.39 g/mol. Its IUPAC name is 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,9'-spirobi[fluorene]-2',7'-dicarbonitrile.
| Compound Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,9'-spirobi[fluorene]-2',7'-dicarbonitrile |
|---|---|
| PubChem CID | 171832539 |
| Molecular Formula | C33H25BN2O2 |
| Molecular Weight | 492.39 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,9'-spirobi[fluorene]-2',7'-dicarbonitrile |
| SMILES | CC1(C)OB(c2ccc3c(c2)C2(c4ccccc4-3)c3cc(C#N)ccc3-c3ccc(C#N)cc32)OC1(C)C |
| InChI | InChI=1S/C33H25BN2O2/c1-31(2)32(3,4)38-34(37-31)22-11-14-26-23-7-5-6-8-27(23)33(30(26)17-22)28-15-20(18-35)9-12-24(28)25-13-10-21(19-36)16-29(25)33/h5-17H,1-4H3 |
| InChIKey | RLASOAOSXNWFIA-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.39 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|