C30H28BNO2 — CID 142384799
4-[9-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-9-yl]pyridine (PubChem CID 142384799) has the molecular formula C30H28BNO2 and a molecular weight of 445.37 g/mol. Its IUPAC name is 4-[9-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-9-yl]pyridine.
| Compound Name | 4-[9-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-9-yl]pyridine |
|---|---|
| PubChem CID | 142384799 |
| Molecular Formula | C30H28BNO2 |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 4-[9-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-9-yl]pyridine |
| SMILES | CC1(C)OB(c2ccc3c(c2)C(c2ccccc2)(c2ccncc2)c2ccccc2-3)OC1(C)C |
| InChI | InChI=1S/C30H28BNO2/c1-28(2)29(3,4)34-31(33-28)23-14-15-25-24-12-8-9-13-26(24)30(27(25)20-23,21-10-6-5-7-11-21)22-16-18-32-19-17-22/h5-20H,1-4H3 |
| InChIKey | TUTKMKLUHFCHRZ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|