C44H34BNO3 — CID 156675419
4-[4-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[fluorene-9,9'-xanthene]-4-yl]phenyl]benzonitrile (PubChem CID 156675419) has the molecular formula C44H34BNO3 and a molecular weight of 635.57 g/mol. Its IUPAC name is 4-[4-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[fluorene-9,9'-xanthene]-4-yl]phenyl]benzonitrile.
| Compound Name | 4-[4-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[fluorene-9,9'-xanthene]-4-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 156675419 |
| Molecular Formula | C44H34BNO3 |
| Molecular Weight | 635.57 g/mol |
| Exact Mass | 635.26 |
| IUPAC Name | 4-[4-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[fluorene-9,9'-xanthene]-4-yl]phenyl]benzonitrile |
| SMILES | CC1(C)OB(c2ccc3c(c2)C2(c4ccccc4Oc4ccccc42)c2cccc(-c4ccc(-c5ccc(C#N)cc5)cc4)c2-3)OC1(C)C |
| InChI | InChI=1S/C44H34BNO3/c1-42(2)43(3,4)49-45(48-42)32-24-25-34-38(26-32)44(35-11-5-7-14-39(35)47-40-15-8-6-12-36(40)44)37-13-9-10-33(41(34)37)31-22-20-30(21-23-31)29-18-16-28(27-46)17-19-29/h5-26H,1-4H3 |
| InChIKey | DUCBBDIIHBOKEK-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.57 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|