C35H30BNO2 — CID 140958538
4-[4-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]naphthalen-1-yl]phenyl]benzonitrile (PubChem CID 140958538) has the molecular formula C35H30BNO2 and a molecular weight of 507.44 g/mol. Its IUPAC name is 4-[4-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]naphthalen-1-yl]phenyl]benzonitrile.
| Compound Name | 4-[4-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]naphthalen-1-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 140958538 |
| Molecular Formula | C35H30BNO2 |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 4-[4-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]naphthalen-1-yl]phenyl]benzonitrile |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(-c4ccc(-c5ccc(C#N)cc5)cc4)c4ccccc34)cc2)OC1(C)C |
| InChI | InChI=1S/C35H30BNO2/c1-34(2)35(3,4)39-36(38-34)29-19-17-28(18-20-29)31-22-21-30(32-7-5-6-8-33(31)32)27-15-13-26(14-16-27)25-11-9-24(23-37)10-12-25/h5-22H,1-4H3 |
| InChIKey | SVEPBCXFRIQPRF-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|