C29H33B2NO4 — CID 162467647
4-[3,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]benzonitrile (PubChem CID 162467647) has the molecular formula C29H33B2NO4 and a molecular weight of 481.21 g/mol. Its IUPAC name is 4-[3,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]benzonitrile.
| Compound Name | 4-[3,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 162467647 |
| Molecular Formula | C29H33B2NO4 |
| Molecular Weight | 481.21 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | 4-[3,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]benzonitrile |
| SMILES | CC1(C)OB(c2c(-c3ccc(C#N)cc3)cc3ccccc3c2B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C29H33B2NO4/c1-26(2)27(3,4)34-30(33-26)24-22-12-10-9-11-21(22)17-23(20-15-13-19(18-32)14-16-20)25(24)31-35-28(5,6)29(7,8)36-31/h9-17H,1-8H3 |
| InChIKey | LISIEYKDDXCTDU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.21 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|