C27H24BNO2 — CID 140824444
4-[10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anthracen-9-yl]benzonitrile (PubChem CID 140824444) has the molecular formula C27H24BNO2 and a molecular weight of 405.31 g/mol. Its IUPAC name is 4-[10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anthracen-9-yl]benzonitrile.
| Compound Name | 4-[10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anthracen-9-yl]benzonitrile |
|---|---|
| PubChem CID | 140824444 |
| Molecular Formula | C27H24BNO2 |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 4-[10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anthracen-9-yl]benzonitrile |
| SMILES | CC1(C)OB(c2c3ccccc3c(-c3ccc(C#N)cc3)c3ccccc23)OC1(C)C |
| InChI | InChI=1S/C27H24BNO2/c1-26(2)27(3,4)31-28(30-26)25-22-11-7-5-9-20(22)24(21-10-6-8-12-23(21)25)19-15-13-18(17-29)14-16-19/h5-16H,1-4H3 |
| InChIKey | VEHWEHBTBVCLCI-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|