C35H31BN2O3 — CID 174109712
1-[2-(4-cyanophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6,6-dimethylbenzo[c]chromene-8-carbonitrile (PubChem CID 174109712) has the molecular formula C35H31BN2O3 and a molecular weight of 538.46 g/mol. Its IUPAC name is 1-[2-(4-cyanophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6,6-dimethylbenzo[c]chromene-8-carbonitrile.
| Compound Name | 1-[2-(4-cyanophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6,6-dimethylbenzo[c]chromene-8-carbonitrile |
|---|---|
| PubChem CID | 174109712 |
| Molecular Formula | C35H31BN2O3 |
| Molecular Weight | 538.46 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 1-[2-(4-cyanophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6,6-dimethylbenzo[c]chromene-8-carbonitrile |
| SMILES | CC1(C)Oc2cccc(-c3cc(B4OC(C)(C)C(C)(C)O4)ccc3-c3ccc(C#N)cc3)c2-c2ccc(C#N)cc21 |
| InChI | InChI=1S/C35H31BN2O3/c1-33(2)30-18-23(21-38)12-16-28(30)32-27(8-7-9-31(32)39-33)29-19-25(36-40-34(3,4)35(5,6)41-36)15-17-26(29)24-13-10-22(20-37)11-14-24/h7-19H,1-6H3 |
| InChIKey | KAFVXMSCJBBMFJ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 75.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.46 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|