C33H32BFO3 — CID 168803043
2-[3-(6,6-dimethylbenzo[c]chromen-7-yl)-4-(4-fluorophenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 168803043) has the molecular formula C33H32BFO3 and a molecular weight of 506.43 g/mol. Its IUPAC name is 2-[3-(6,6-dimethylbenzo[c]chromen-7-yl)-4-(4-fluorophenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-(6,6-dimethylbenzo[c]chromen-7-yl)-4-(4-fluorophenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 168803043 |
| Molecular Formula | C33H32BFO3 |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 2-[3-(6,6-dimethylbenzo[c]chromen-7-yl)-4-(4-fluorophenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)Oc2ccccc2-c2cccc(-c3cc(B4OC(C)(C)C(C)(C)O4)ccc3-c3ccc(F)cc3)c21 |
| InChI | InChI=1S/C33H32BFO3/c1-31(2)30-26(25-10-7-8-13-29(25)36-31)11-9-12-27(30)28-20-22(34-37-32(3,4)33(5,6)38-34)16-19-24(28)21-14-17-23(35)18-15-21/h7-20H,1-6H3 |
| InChIKey | BEFJCRQNOLRQGC-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|