C24H22BClO4 — CID 174258908
2-(3-chloro-4-dibenzo-p-dioxin-2-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 174258908) has the molecular formula C24H22BClO4 and a molecular weight of 420.70 g/mol. Its IUPAC name is 2-(3-chloro-4-dibenzo-p-dioxin-2-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(3-chloro-4-dibenzo-p-dioxin-2-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 174258908 |
| Molecular Formula | C24H22BClO4 |
| Molecular Weight | 420.70 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2-(3-chloro-4-dibenzo-p-dioxin-2-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(-c3ccc4c(c3)Oc3ccccc3O4)c(Cl)c2)OC1(C)C |
| InChI | InChI=1S/C24H22BClO4/c1-23(2)24(3,4)30-25(29-23)16-10-11-17(18(26)14-16)15-9-12-21-22(13-15)28-20-8-6-5-7-19(20)27-21/h5-14H,1-4H3 |
| InChIKey | WTDABLHBZIYJPS-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.70 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|