C24H21BO4S — CID 176586582
18-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-14,21-dioxa-10-thiapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15(20),16,18-nonaene (PubChem CID 176586582) has the molecular formula C24H21BO4S and a molecular weight of 416.31 g/mol. Its IUPAC name is 18-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-14,21-dioxa-10-thiapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15(20),16,18-nonaene.
| Compound Name | 18-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-14,21-dioxa-10-thiapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 176586582 |
| Molecular Formula | C24H21BO4S |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 18-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-14,21-dioxa-10-thiapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15(20),16,18-nonaene |
| SMILES | CC1(C)OB(c2ccc3c(c2)Oc2cc4c(cc2O3)sc2ccccc24)OC1(C)C |
| InChI | InChI=1S/C24H21BO4S/c1-23(2)24(3,4)29-25(28-23)14-9-10-17-18(11-14)27-19-12-16-15-7-5-6-8-21(15)30-22(16)13-20(19)26-17/h5-13H,1-4H3 |
| InChIKey | WNGDLJXKRHRTDK-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|