C23H25BO2S — CID 168815422
2-(10,10-dimethylindeno[1,2-b][1]benzothiol-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 168815422) has the molecular formula C23H25BO2S and a molecular weight of 376.33 g/mol. Its IUPAC name is 2-(10,10-dimethylindeno[1,2-b][1]benzothiol-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(10,10-dimethylindeno[1,2-b][1]benzothiol-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 168815422 |
| Molecular Formula | C23H25BO2S |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2-(10,10-dimethylindeno[1,2-b][1]benzothiol-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)c2ccc(B3OC(C)(C)C(C)(C)O3)cc2-c2sc3ccccc3c21 |
| InChI | InChI=1S/C23H25BO2S/c1-21(2)17-12-11-14(24-25-22(3,4)23(5,6)26-24)13-16(17)20-19(21)15-9-7-8-10-18(15)27-20/h7-13H,1-6H3 |
| InChIKey | WNOUKBODFXKDOX-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|