C38H31BN2O2 — CID 153452270
4-[7'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[10H-acridine-9,9'-fluorene]-2'-yl]benzonitrile (PubChem CID 153452270) has the molecular formula C38H31BN2O2 and a molecular weight of 558.49 g/mol. Its IUPAC name is 4-[7'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[10H-acridine-9,9'-fluorene]-2'-yl]benzonitrile.
| Compound Name | 4-[7'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[10H-acridine-9,9'-fluorene]-2'-yl]benzonitrile |
|---|---|
| PubChem CID | 153452270 |
| Molecular Formula | C38H31BN2O2 |
| Molecular Weight | 558.49 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | 4-[7'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[10H-acridine-9,9'-fluorene]-2'-yl]benzonitrile |
| SMILES | CC1(C)OB(c2ccc3c(c2)C2(c4ccccc4Nc4ccccc42)c2cc(-c4ccc(C#N)cc4)ccc2-3)OC1(C)C |
| InChI | InChI=1S/C38H31BN2O2/c1-36(2)37(3,4)43-39(42-36)27-18-20-29-28-19-17-26(25-15-13-24(23-40)14-16-25)21-32(28)38(33(29)22-27)30-9-5-7-11-34(30)41-35-12-8-6-10-31(35)38/h5-22,41H,1-4H3 |
| InChIKey | MKKNAWNCGHGOJU-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.49 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|