C39H42B2O4 — CID 58174900
4,4,5,5-tetramethyl-2-[7'-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]spiro[1,3-dihydroindene-2,9'-fluorene]-2'-yl]-1,3,2-dioxaborolane (PubChem CID 58174900) has the molecular formula C39H42B2O4 and a molecular weight of 596.39 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[7'-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]spiro[1,3-dihydroindene-2,9'-fluorene]-2'-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[7'-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]spiro[1,3-dihydroindene-2,9'-fluorene]-2'-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 58174900 |
| Molecular Formula | C39H42B2O4 |
| Molecular Weight | 596.39 g/mol |
| Exact Mass | 596.33 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[7'-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]spiro[1,3-dihydroindene-2,9'-fluorene]-2'-yl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(-c3ccc4c(c3)C3(Cc5ccccc5C3)c3cc(B5OC(C)(C)C(C)(C)O5)ccc3-4)cc2)OC1(C)C |
| InChI | InChI=1S/C39H42B2O4/c1-35(2)36(3,4)43-40(42-35)29-16-13-25(14-17-29)26-15-19-31-32-20-18-30(41-44-37(5,6)38(7,8)45-41)22-34(32)39(33(31)21-26)23-27-11-9-10-12-28(27)24-39/h9-22H,23-24H2,1-8H3 |
| InChIKey | NQDKQDYDCAAHFB-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.39 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|