C34H37BO2 — CID 164819128
4,4,5,5-tetramethyl-2-(4-spiro[adamantane-2,9'-fluorene]-2'-ylphenyl)-1,3,2-dioxaborolane (PubChem CID 164819128) has the molecular formula C34H37BO2 and a molecular weight of 488.48 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(4-spiro[adamantane-2,9'-fluorene]-2'-ylphenyl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(4-spiro[adamantane-2,9'-fluorene]-2'-ylphenyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 164819128 |
| Molecular Formula | C34H37BO2 |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(4-spiro[adamantane-2,9'-fluorene]-2'-ylphenyl)-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(-c3ccc4c(c3)C3(c5ccccc5-4)C4CC5CC(C4)CC3C5)cc2)OC1(C)C |
| InChI | InChI=1S/C34H37BO2/c1-32(2)33(3,4)37-35(36-32)27-12-9-23(10-13-27)24-11-14-29-28-7-5-6-8-30(28)34(31(29)20-24)25-16-21-15-22(18-25)19-26(34)17-21/h5-14,20-22,25-26H,15-19H2,1-4H3 |
| InChIKey | JFSWVGFXPMMPNW-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|