C27H32BNO2 — CID 174030858
3'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[adamantane-2,9'-indeno[2,1-b]pyridine] (PubChem CID 174030858) has the molecular formula C27H32BNO2 and a molecular weight of 413.37 g/mol. Its IUPAC name is 3'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[adamantane-2,9'-indeno[2,1-b]pyridine].
| Compound Name | 3'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[adamantane-2,9'-indeno[2,1-b]pyridine] |
|---|---|
| PubChem CID | 174030858 |
| Molecular Formula | C27H32BNO2 |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 3'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[adamantane-2,9'-indeno[2,1-b]pyridine] |
| SMILES | CC1(C)OB(c2cnc3c(c2)-c2ccccc2C32C3CC4CC(C3)CC2C4)OC1(C)C |
| InChI | InChI=1S/C27H32BNO2/c1-25(2)26(3,4)31-28(30-25)20-14-22-21-7-5-6-8-23(21)27(24(22)29-15-20)18-10-16-9-17(12-18)13-19(27)11-16/h5-8,14-19H,9-13H2,1-4H3 |
| InChIKey | URFUOBYFJADHDY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|