C29H37BO2 — CID 172603786
2-(3,7-dimethylspiro[bicyclo[3.3.1]nonane-2,9'-fluorene]-4'-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 172603786) has the molecular formula C29H37BO2 and a molecular weight of 428.43 g/mol. Its IUPAC name is 2-(3,7-dimethylspiro[bicyclo[3.3.1]nonane-2,9'-fluorene]-4'-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(3,7-dimethylspiro[bicyclo[3.3.1]nonane-2,9'-fluorene]-4'-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 172603786 |
| Molecular Formula | C29H37BO2 |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 2-(3,7-dimethylspiro[bicyclo[3.3.1]nonane-2,9'-fluorene]-4'-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1CC2CC(C)C3(c4ccccc4-c4c(B5OC(C)(C)C(C)(C)O5)cccc43)C(C1)C2 |
| InChI | InChI=1S/C29H37BO2/c1-18-14-20-16-19(2)29(21(15-18)17-20)23-11-8-7-10-22(23)26-24(29)12-9-13-25(26)30-31-27(3,4)28(5,6)32-30/h7-13,18-21H,14-17H2,1-6H3 |
| InChIKey | BBEBFQYSBGAWOC-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|