C28H35BO2 — CID 164819559
4,4,5,5-tetramethyl-2-(7-methylspiro[bicyclo[3.3.1]nonane-2,9'-fluorene]-4'-yl)-1,3,2-dioxaborolane (PubChem CID 164819559) has the molecular formula C28H35BO2 and a molecular weight of 414.40 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(7-methylspiro[bicyclo[3.3.1]nonane-2,9'-fluorene]-4'-yl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(7-methylspiro[bicyclo[3.3.1]nonane-2,9'-fluorene]-4'-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 164819559 |
| Molecular Formula | C28H35BO2 |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(7-methylspiro[bicyclo[3.3.1]nonane-2,9'-fluorene]-4'-yl)-1,3,2-dioxaborolane |
| SMILES | CC1CC2CCC3(c4ccccc4-c4c(B5OC(C)(C)C(C)(C)O5)cccc43)C(C1)C2 |
| InChI | InChI=1S/C28H35BO2/c1-18-15-19-13-14-28(20(16-18)17-19)22-10-7-6-9-21(22)25-23(28)11-8-12-24(25)29-30-26(2,3)27(4,5)31-29/h6-12,18-20H,13-17H2,1-5H3 |
| InChIKey | NSJOHRWGTRSDIC-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|