C32H29NO2 — CID 164819440
7-methyl-1'-(3-nitronaphthalen-2-yl)spiro[bicyclo[3.3.1]nonane-2,9'-fluorene] (PubChem CID 164819440) has the molecular formula C32H29NO2 and a molecular weight of 459.59 g/mol. Its IUPAC name is 7-methyl-1'-(3-nitronaphthalen-2-yl)spiro[bicyclo[3.3.1]nonane-2,9'-fluorene].
| Compound Name | 7-methyl-1'-(3-nitronaphthalen-2-yl)spiro[bicyclo[3.3.1]nonane-2,9'-fluorene] |
|---|---|
| PubChem CID | 164819440 |
| Molecular Formula | C32H29NO2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 7-methyl-1'-(3-nitronaphthalen-2-yl)spiro[bicyclo[3.3.1]nonane-2,9'-fluorene] |
| SMILES | CC1CC2CCC3(c4ccccc4-c4cccc(-c5cc6ccccc6cc5[N+](=O)[O-])c43)C(C1)C2 |
| InChI | InChI=1S/C32H29NO2/c1-20-15-21-13-14-32(24(16-20)17-21)29-12-5-4-9-25(29)26-10-6-11-27(31(26)32)28-18-22-7-2-3-8-23(22)19-30(28)33(34)35/h2-12,18-21,24H,13-17H2,1H3 |
| InChIKey | BOYFYFNBUIPGSZ-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|