C28H27NO2 — CID 164819532
7-methyl-4'-(2-nitrophenyl)spiro[bicyclo[3.3.1]nonane-2,9'-fluorene] (PubChem CID 164819532) has the molecular formula C28H27NO2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 7-methyl-4'-(2-nitrophenyl)spiro[bicyclo[3.3.1]nonane-2,9'-fluorene].
| Compound Name | 7-methyl-4'-(2-nitrophenyl)spiro[bicyclo[3.3.1]nonane-2,9'-fluorene] |
|---|---|
| PubChem CID | 164819532 |
| Molecular Formula | C28H27NO2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 7-methyl-4'-(2-nitrophenyl)spiro[bicyclo[3.3.1]nonane-2,9'-fluorene] |
| SMILES | CC1CC2CCC3(c4ccccc4-c4c(-c5ccccc5[N+](=O)[O-])cccc43)C(C1)C2 |
| InChI | InChI=1S/C28H27NO2/c1-18-15-19-13-14-28(20(16-18)17-19)24-10-4-2-8-23(24)27-22(9-6-11-25(27)28)21-7-3-5-12-26(21)29(30)31/h2-12,18-20H,13-17H2,1H3 |
| InChIKey | XEJZDKXLKPXABP-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|