C21H17NO2 — CID 175669556
9,9-dimethyl-4-(2-nitrophenyl)fluorene (PubChem CID 175669556) has the molecular formula C21H17NO2 and a molecular weight of 315.37 g/mol. Its IUPAC name is 9,9-dimethyl-4-(2-nitrophenyl)fluorene.
| Compound Name | 9,9-dimethyl-4-(2-nitrophenyl)fluorene |
|---|---|
| PubChem CID | 175669556 |
| Molecular Formula | C21H17NO2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 9,9-dimethyl-4-(2-nitrophenyl)fluorene |
| SMILES | CC1(C)c2ccccc2-c2c(-c3ccccc3[N+](=O)[O-])cccc21 |
| InChI | InChI=1S/C21H17NO2/c1-21(2)17-11-5-3-9-16(17)20-15(10-7-12-18(20)21)14-8-4-6-13-19(14)22(23)24/h3-13H,1-2H3 |
| InChIKey | SLINWBQKZBYQEB-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|