C34H30N2S — CID 155467276
2,5-bis(9,9-dimethylfluoren-4-yl)thiophene-3,4-diamine (PubChem CID 155467276) has the molecular formula C34H30N2S and a molecular weight of 498.70 g/mol. Its IUPAC name is 2,5-bis(9,9-dimethylfluoren-4-yl)thiophene-3,4-diamine.
| Compound Name | 2,5-bis(9,9-dimethylfluoren-4-yl)thiophene-3,4-diamine |
|---|---|
| PubChem CID | 155467276 |
| Molecular Formula | C34H30N2S |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 2,5-bis(9,9-dimethylfluoren-4-yl)thiophene-3,4-diamine |
| SMILES | CC1(C)c2ccccc2-c2c(-c3sc(-c4cccc5c4-c4ccccc4C5(C)C)c(N)c3N)cccc21 |
| InChI | InChI=1S/C34H30N2S/c1-33(2)23-15-7-5-11-19(23)27-21(13-9-17-25(27)33)31-29(35)30(36)32(37-31)22-14-10-18-26-28(22)20-12-6-8-16-24(20)34(26,3)4/h5-18H,35-36H2,1-4H3 |
| InChIKey | FVSCJQWJRVILJT-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |