C21H18FN — CID 90264164
3-(9,9-dimethylfluoren-4-yl)-5-fluoroaniline (PubChem CID 90264164) has the molecular formula C21H18FN and a molecular weight of 303.38 g/mol. Its IUPAC name is 3-(9,9-dimethylfluoren-4-yl)-5-fluoroaniline.
| Compound Name | 3-(9,9-dimethylfluoren-4-yl)-5-fluoroaniline |
|---|---|
| PubChem CID | 90264164 |
| Molecular Formula | C21H18FN |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 3-(9,9-dimethylfluoren-4-yl)-5-fluoroaniline |
| SMILES | CC1(C)c2ccccc2-c2c(-c3cc(N)cc(F)c3)cccc21 |
| InChI | InChI=1S/C21H18FN/c1-21(2)18-8-4-3-6-17(18)20-16(7-5-9-19(20)21)13-10-14(22)12-15(23)11-13/h3-12H,23H2,1-2H3 |
| InChIKey | LDTBOVQATQALKW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|