C25H19NO2 — CID 126621942
11,11-dimethyl-3-(2-nitrophenyl)benzo[a]fluorene (PubChem CID 126621942) has the molecular formula C25H19NO2 and a molecular weight of 365.43 g/mol. Its IUPAC name is 11,11-dimethyl-3-(2-nitrophenyl)benzo[a]fluorene.
| Compound Name | 11,11-dimethyl-3-(2-nitrophenyl)benzo[a]fluorene |
|---|---|
| PubChem CID | 126621942 |
| Molecular Formula | C25H19NO2 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 11,11-dimethyl-3-(2-nitrophenyl)benzo[a]fluorene |
| SMILES | CC1(C)c2ccccc2-c2ccc3cc(-c4ccccc4[N+](=O)[O-])ccc3c21 |
| InChI | InChI=1S/C25H19NO2/c1-25(2)22-9-5-3-8-20(22)21-14-12-17-15-16(11-13-19(17)24(21)25)18-7-4-6-10-23(18)26(27)28/h3-15H,1-2H3 |
| InChIKey | YLDBYRGXDFNVRL-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|