C21H16BrNO2 — CID 130288813
2-(5-bromo-2-nitrophenyl)-9,9-dimethylfluorene (PubChem CID 130288813) has the molecular formula C21H16BrNO2 and a molecular weight of 394.27 g/mol. Its IUPAC name is 2-(5-bromo-2-nitrophenyl)-9,9-dimethylfluorene.
| Compound Name | 2-(5-bromo-2-nitrophenyl)-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 130288813 |
| Molecular Formula | C21H16BrNO2 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 2-(5-bromo-2-nitrophenyl)-9,9-dimethylfluorene |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3cc(Br)ccc3[N+](=O)[O-])cc21 |
| InChI | InChI=1S/C21H16BrNO2/c1-21(2)18-6-4-3-5-15(18)16-9-7-13(11-19(16)21)17-12-14(22)8-10-20(17)23(24)25/h3-12H,1-2H3 |
| InChIKey | OPDKUTBOCCACGE-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|