C23H17BrN2O2 — CID 90177174
11-(5-bromo-2-nitrophenyl)-8,8-dimethyl-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene (PubChem CID 90177174) has the molecular formula C23H17BrN2O2 and a molecular weight of 433.31 g/mol. Its IUPAC name is 11-(5-bromo-2-nitrophenyl)-8,8-dimethyl-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene.
| Compound Name | 11-(5-bromo-2-nitrophenyl)-8,8-dimethyl-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene |
|---|---|
| PubChem CID | 90177174 |
| Molecular Formula | C23H17BrN2O2 |
| Molecular Weight | 433.31 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 11-(5-bromo-2-nitrophenyl)-8,8-dimethyl-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene |
| SMILES | CC1(C)c2ccccc2-n2ccc3cc(-c4cc(Br)ccc4[N+](=O)[O-])cc1c32 |
| InChI | InChI=1S/C23H17BrN2O2/c1-23(2)18-5-3-4-6-21(18)25-10-9-14-11-15(12-19(23)22(14)25)17-13-16(24)7-8-20(17)26(27)28/h3-13H,1-2H3 |
| InChIKey | UXWCSHVFHXMHFV-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.31 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|