C29H22N2O2 — CID 90035742
1-(9,9-dimethylfluoren-2-yl)-5-(2-nitrophenyl)indole (PubChem CID 90035742) has the molecular formula C29H22N2O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 1-(9,9-dimethylfluoren-2-yl)-5-(2-nitrophenyl)indole.
| Compound Name | 1-(9,9-dimethylfluoren-2-yl)-5-(2-nitrophenyl)indole |
|---|---|
| PubChem CID | 90035742 |
| Molecular Formula | C29H22N2O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 1-(9,9-dimethylfluoren-2-yl)-5-(2-nitrophenyl)indole |
| SMILES | CC1(C)c2ccccc2-c2ccc(-n3ccc4cc(-c5ccccc5[N+](=O)[O-])ccc43)cc21 |
| InChI | InChI=1S/C29H22N2O2/c1-29(2)25-9-5-3-8-23(25)24-13-12-21(18-26(24)29)30-16-15-20-17-19(11-14-27(20)30)22-7-4-6-10-28(22)31(32)33/h3-18H,1-2H3 |
| InChIKey | CFQFFGVNTXJCOR-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|