C32H21N3O2 — CID 90257402
7-(2-nitrophenyl)-3,10-diphenylpyrrolo[3,2-a]carbazole (PubChem CID 90257402) has the molecular formula C32H21N3O2 and a molecular weight of 479.54 g/mol. Its IUPAC name is 7-(2-nitrophenyl)-3,10-diphenylpyrrolo[3,2-a]carbazole.
| Compound Name | 7-(2-nitrophenyl)-3,10-diphenylpyrrolo[3,2-a]carbazole |
|---|---|
| PubChem CID | 90257402 |
| Molecular Formula | C32H21N3O2 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 7-(2-nitrophenyl)-3,10-diphenylpyrrolo[3,2-a]carbazole |
| SMILES | O=[N+]([O-])c1ccccc1-c1ccc2c(c1)c1ccc3c(ccn3-c3ccccc3)c1n2-c1ccccc1 |
| InChI | InChI=1S/C32H21N3O2/c36-35(37)31-14-8-7-13-25(31)22-15-17-30-28(21-22)26-16-18-29-27(19-20-33(29)23-9-3-1-4-10-23)32(26)34(30)24-11-5-2-6-12-24/h1-21H |
| InChIKey | QHDVQKWMGOMXDM-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 53.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|