C23H18N2O2 — CID 90257397
10,10-dimethyl-9-(2-nitrophenyl)-5H-indeno[1,2-b]indole (PubChem CID 90257397) has the molecular formula C23H18N2O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 10,10-dimethyl-9-(2-nitrophenyl)-5H-indeno[1,2-b]indole.
| Compound Name | 10,10-dimethyl-9-(2-nitrophenyl)-5H-indeno[1,2-b]indole |
|---|---|
| PubChem CID | 90257397 |
| Molecular Formula | C23H18N2O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 10,10-dimethyl-9-(2-nitrophenyl)-5H-indeno[1,2-b]indole |
| SMILES | CC1(C)c2ccccc2-c2[nH]c3cccc(-c4ccccc4[N+](=O)[O-])c3c21 |
| InChI | InChI=1S/C23H18N2O2/c1-23(2)17-11-5-3-9-16(17)22-21(23)20-15(10-7-12-18(20)24-22)14-8-4-6-13-19(14)25(26)27/h3-13,24H,1-2H3 |
| InChIKey | PNKXSBBSDDALMF-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|