C14H10N6O4 — CID 134109320
3,6-bis(2-nitrophenyl)-1,4-dihydro-1,2,4,5-tetrazine (PubChem CID 134109320) has the molecular formula C14H10N6O4 and a molecular weight of 326.27 g/mol. Its IUPAC name is 3,6-bis(2-nitrophenyl)-1,4-dihydro-1,2,4,5-tetrazine.
| Compound Name | 3,6-bis(2-nitrophenyl)-1,4-dihydro-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 134109320 |
| Molecular Formula | C14H10N6O4 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 3,6-bis(2-nitrophenyl)-1,4-dihydro-1,2,4,5-tetrazine |
| SMILES | O=[N+]([O-])c1ccccc1C1=NNC(c2ccccc2[N+](=O)[O-])=NN1 |
| InChI | InChI=1S/C14H10N6O4/c21-19(22)11-7-3-1-5-9(11)13-15-17-14(18-16-13)10-6-2-4-8-12(10)20(23)24/h1-8H,(H,15,16)(H,17,18) |
| InChIKey | UXFHERYZFHOTGX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 135.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|