C28H25NO2 — CID 164819428
1'-(2-nitrophenyl)spiro[adamantane-2,9'-fluorene] (PubChem CID 164819428) has the molecular formula C28H25NO2 and a molecular weight of 407.51 g/mol. Its IUPAC name is 1'-(2-nitrophenyl)spiro[adamantane-2,9'-fluorene].
| Compound Name | 1'-(2-nitrophenyl)spiro[adamantane-2,9'-fluorene] |
|---|---|
| PubChem CID | 164819428 |
| Molecular Formula | C28H25NO2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 1'-(2-nitrophenyl)spiro[adamantane-2,9'-fluorene] |
| SMILES | O=[N+]([O-])c1ccccc1-c1cccc2c1C1(c3ccccc3-2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C28H25NO2/c30-29(31)26-11-4-2-7-22(26)24-9-5-8-23-21-6-1-3-10-25(21)28(27(23)24)19-13-17-12-18(15-19)16-20(28)14-17/h1-11,17-20H,12-16H2 |
| InChIKey | UUGXEKIPLFAEIA-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|