C36H30N4 — CID 167268553
8'-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[adamantane-2,9'-indeno[2,1-c]pyridine] (PubChem CID 167268553) has the molecular formula C36H30N4 and a molecular weight of 518.66 g/mol. Its IUPAC name is 8'-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[adamantane-2,9'-indeno[2,1-c]pyridine].
| Compound Name | 8'-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[adamantane-2,9'-indeno[2,1-c]pyridine] |
|---|---|
| PubChem CID | 167268553 |
| Molecular Formula | C36H30N4 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 8'-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[adamantane-2,9'-indeno[2,1-c]pyridine] |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc4c3C3(c5cnccc5-4)C4CC5CC(C4)CC3C5)n2)cc1 |
| InChI | InChI=1S/C36H30N4/c1-3-8-24(9-4-1)33-38-34(25-10-5-2-6-11-25)40-35(39-33)30-13-7-12-29-28-14-15-37-21-31(28)36(32(29)30)26-17-22-16-23(19-26)20-27(36)18-22/h1-15,21-23,26-27H,16-20H2 |
| InChIKey | KPVYSLCGASBQTB-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |