C35H29N5 — CID 167270023
4-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8,2'-adamantane] (PubChem CID 167270023) has the molecular formula C35H29N5 and a molecular weight of 519.65 g/mol. Its IUPAC name is 4-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8,2'-adamantane].
| Compound Name | 4-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8,2'-adamantane] |
|---|---|
| PubChem CID | 167270023 |
| Molecular Formula | C35H29N5 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | 4-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8,2'-adamantane] |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cnc4c(c3)-c3cccnc3C43C4CC5CC(C4)CC3C5)n2)cc1 |
| InChI | InChI=1S/C35H29N5/c1-3-8-23(9-4-1)32-38-33(24-10-5-2-6-11-24)40-34(39-32)25-19-29-28-12-7-13-36-30(28)35(31(29)37-20-25)26-15-21-14-22(17-26)18-27(35)16-21/h1-13,19-22,26-27H,14-18H2 |
| InChIKey | DYKGUHWFNGDFET-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |