C64H48N6 — CID 164819047
2-[3-[6'-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]spiro[adamantane-2,9'-fluorene]-3'-yl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 164819047) has the molecular formula C64H48N6 and a molecular weight of 901.13 g/mol. Its IUPAC name is 2-[3-[6'-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]spiro[adamantane-2,9'-fluorene]-3'-yl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-[6'-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]spiro[adamantane-2,9'-fluorene]-3'-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 164819047 |
| Molecular Formula | C64H48N6 |
| Molecular Weight | 901.13 g/mol |
| Exact Mass | 900.39 |
| IUPAC Name | 2-[3-[6'-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]spiro[adamantane-2,9'-fluorene]-3'-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc5c(c4)-c4cc(-c6cccc(-c7nc(-c8ccccc8)nc(-c8ccccc8)n7)c6)ccc4C54C5CC6CC(C5)CC4C6)cc3)n2)cc1 |
| InChI | InChI=1S/C64H48N6/c1-5-14-43(15-6-1)58-65-59(44-16-7-2-8-17-44)68-62(67-58)47-26-24-42(25-27-47)49-28-30-56-54(38-49)55-39-50(29-31-57(55)64(56)52-33-40-32-41(35-52)36-53(64)34-40)48-22-13-23-51(37-48)63-69-60(45-18-9-3-10-19-45)66-61(70-63)46-20-11-4-12-21-46/h1-31,37-41,52-53H,32-36H2 |
| InChIKey | AVXGCPDVAPFEKG-UHFFFAOYSA-N |
| XLogP | 15.12 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.13 |
| LogP ≤ 5 | 15.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |