C57H43N7 — CID 164818888
2-[7'-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]spiro[adamantane-2,9'-fluorene]-3'-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 164818888) has the molecular formula C57H43N7 and a molecular weight of 826.02 g/mol. Its IUPAC name is 2-[7'-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]spiro[adamantane-2,9'-fluorene]-3'-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[7'-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]spiro[adamantane-2,9'-fluorene]-3'-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 164818888 |
| Molecular Formula | C57H43N7 |
| Molecular Weight | 826.02 g/mol |
| Exact Mass | 825.36 |
| IUPAC Name | 2-[7'-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]spiro[adamantane-2,9'-fluorene]-3'-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)-c3ccc(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)n5)cc3C43C4CC5CC(C4)CC3C5)n2)cc1 |
| InChI | InChI=1S/C57H43N7/c1-5-14-37(15-6-1)51-59-52(38-16-7-2-8-17-38)62-55(61-51)42-25-27-47-46(33-42)45-26-24-41(34-48(45)57(47)43-29-35-28-36(31-43)32-44(57)30-35)49-22-13-23-50(58-49)56-63-53(39-18-9-3-10-19-39)60-54(64-56)40-20-11-4-12-21-40/h1-27,33-36,43-44H,28-32H2 |
| InChIKey | PQGMMFLCYYAMLR-UHFFFAOYSA-N |
| XLogP | 12.84 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.02 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |