C62H46N8 — CID 164818946
2-[6-[7'-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]spiro[adamantane-2,9'-fluorene]-2'-yl]-3-pyridinyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 164818946) has the molecular formula C62H46N8 and a molecular weight of 903.11 g/mol. Its IUPAC name is 2-[6-[7'-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]spiro[adamantane-2,9'-fluorene]-2'-yl]-3-pyridinyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[6-[7'-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]spiro[adamantane-2,9'-fluorene]-2'-yl]-3-pyridinyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 164818946 |
| Molecular Formula | C62H46N8 |
| Molecular Weight | 903.11 g/mol |
| Exact Mass | 902.38 |
| IUPAC Name | 2-[6-[7'-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]spiro[adamantane-2,9'-fluorene]-2'-yl]-3-pyridinyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc5c(c4)C4(c6cc(-c7ccc(-c8nc(-c9ccccc9)nc(-c9ccccc9)n8)cn7)ccc6-5)C5CC6CC(C5)CC4C6)nc3)n2)cc1 |
| InChI | InChI=1S/C62H46N8/c1-5-13-40(14-6-1)56-65-57(41-15-7-2-8-16-41)68-60(67-56)46-23-27-54(63-36-46)44-21-25-50-51-26-22-45(35-53(51)62(52(50)34-44)48-30-38-29-39(32-48)33-49(62)31-38)55-28-24-47(37-64-55)61-69-58(42-17-9-3-10-18-42)66-59(70-61)43-19-11-4-12-20-43/h1-28,34-39,48-49H,29-33H2 |
| InChIKey | AOIHGHMARAHEEH-UHFFFAOYSA-N |
| XLogP | 13.91 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.11 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |