C49H38ClN3 — CID 168803912
2-(6'-chlorospiro[adamantane-2,9'-fluorene]-2'-yl)-4,6-bis(4-phenylphenyl)-1,3,5-triazine (PubChem CID 168803912) has the molecular formula C49H38ClN3 and a molecular weight of 704.32 g/mol. Its IUPAC name is 2-(6'-chlorospiro[adamantane-2,9'-fluorene]-2'-yl)-4,6-bis(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(6'-chlorospiro[adamantane-2,9'-fluorene]-2'-yl)-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 168803912 |
| Molecular Formula | C49H38ClN3 |
| Molecular Weight | 704.32 g/mol |
| Exact Mass | 703.28 |
| IUPAC Name | 2-(6'-chlorospiro[adamantane-2,9'-fluorene]-2'-yl)-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
| SMILES | Clc1ccc2c(c1)-c1ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccc(-c5ccccc5)cc4)n3)cc1C21C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C49H38ClN3/c50-41-20-22-44-43(29-41)42-21-19-38(28-45(42)49(44)39-24-30-23-31(26-39)27-40(49)25-30)48-52-46(36-15-11-34(12-16-36)32-7-3-1-4-8-32)51-47(53-48)37-17-13-35(14-18-37)33-9-5-2-6-10-33/h1-22,28-31,39-40H,23-27H2 |
| InChIKey | LBLZTRKISSYCFU-UHFFFAOYSA-N |
| XLogP | 12.58 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.32 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |