C50H41N3 — CID 147428060
2-[3-(4-methylphenyl)-5-spiro[adamantane-2,9'-fluorene]-2'-ylphenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 147428060) has the molecular formula C50H41N3 and a molecular weight of 683.90 g/mol. Its IUPAC name is 2-[3-(4-methylphenyl)-5-spiro[adamantane-2,9'-fluorene]-2'-ylphenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-(4-methylphenyl)-5-spiro[adamantane-2,9'-fluorene]-2'-ylphenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 147428060 |
| Molecular Formula | C50H41N3 |
| Molecular Weight | 683.90 g/mol |
| Exact Mass | 683.33 |
| IUPAC Name | 2-[3-(4-methylphenyl)-5-spiro[adamantane-2,9'-fluorene]-2'-ylphenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Cc1ccc(-c2cc(-c3ccc4c(c3)C3(c5ccccc5-4)C4CC5CC(C4)CC3C5)cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C50H41N3/c1-31-16-18-34(19-17-31)38-27-39(29-40(28-38)49-52-47(35-10-4-2-5-11-35)51-48(53-49)36-12-6-3-7-13-36)37-20-21-44-43-14-8-9-15-45(43)50(46(44)30-37)41-23-32-22-33(25-41)26-42(50)24-32/h2-21,27-30,32-33,41-42H,22-26H2,1H3 |
| InChIKey | DTUCAQGLDOTDID-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.90 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |