C59H43N3 — CID 166017987
2-(4-fluoranthen-8-ylphenyl)-4-phenyl-6-(3-spiro[adamantane-2,9'-fluorene]-2'-ylphenyl)-1,3,5-triazine (PubChem CID 166017987) has the molecular formula C59H43N3 and a molecular weight of 794.01 g/mol. Its IUPAC name is 2-(4-fluoranthen-8-ylphenyl)-4-phenyl-6-(3-spiro[adamantane-2,9'-fluorene]-2'-ylphenyl)-1,3,5-triazine.
| Compound Name | 2-(4-fluoranthen-8-ylphenyl)-4-phenyl-6-(3-spiro[adamantane-2,9'-fluorene]-2'-ylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 166017987 |
| Molecular Formula | C59H43N3 |
| Molecular Weight | 794.01 g/mol |
| Exact Mass | 793.35 |
| IUPAC Name | 2-(4-fluoranthen-8-ylphenyl)-4-phenyl-6-(3-spiro[adamantane-2,9'-fluorene]-2'-ylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccc(-c4ccc5c(c4)-c4cccc6cccc-5c46)cc3)nc(-c3cccc(-c4ccc5c(c4)C4(c6ccccc6-5)C5CC6CC(C5)CC4C6)c3)n2)cc1 |
| InChI | InChI=1S/C59H43N3/c1-2-9-39(10-3-1)56-60-57(40-21-19-37(20-22-40)42-23-25-47-50-16-7-11-38-12-8-17-51(55(38)50)52(47)33-42)62-58(61-56)44-14-6-13-41(32-44)43-24-26-49-48-15-4-5-18-53(48)59(54(49)34-43)45-28-35-27-36(30-45)31-46(59)29-35/h1-26,32-36,45-46H,27-31H2 |
| InChIKey | FLAZOEDKWIWYSG-UHFFFAOYSA-N |
| XLogP | 14.73 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.01 |
| LogP ≤ 5 | 14.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |