C41H43BO2S — CID 174092329
2-[6-(3,7-dimethylspiro[bicyclo[3.3.1]nonane-2,9'-fluorene]-4'-yl)dibenzothiophen-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 174092329) has the molecular formula C41H43BO2S and a molecular weight of 610.67 g/mol. Its IUPAC name is 2-[6-(3,7-dimethylspiro[bicyclo[3.3.1]nonane-2,9'-fluorene]-4'-yl)dibenzothiophen-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[6-(3,7-dimethylspiro[bicyclo[3.3.1]nonane-2,9'-fluorene]-4'-yl)dibenzothiophen-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 174092329 |
| Molecular Formula | C41H43BO2S |
| Molecular Weight | 610.67 g/mol |
| Exact Mass | 610.31 |
| IUPAC Name | 2-[6-(3,7-dimethylspiro[bicyclo[3.3.1]nonane-2,9'-fluorene]-4'-yl)dibenzothiophen-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1CC2CC(C)C3(c4ccccc4-c4c(-c5cccc6c5sc5c(B7OC(C)(C)C(C)(C)O7)cccc56)cccc43)C(C1)C2 |
| InChI | InChI=1S/C41H43BO2S/c1-24-20-26-22-25(2)41(27(21-24)23-26)33-17-8-7-12-32(33)36-28(13-10-18-34(36)41)29-14-9-15-30-31-16-11-19-35(38(31)45-37(29)30)42-43-39(3,4)40(5,6)44-42/h7-19,24-27H,20-23H2,1-6H3 |
| InChIKey | LADFSGIXLHEMDE-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.67 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|