C55H52BN3O2 — CID 176628553
2-phenyl-4-[4-(4-phenylphenyl)phenyl]-6-[4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-adamantyl]phenyl]-1,3,5-triazine (PubChem CID 176628553) has the molecular formula C55H52BN3O2 and a molecular weight of 797.85 g/mol. Its IUPAC name is 2-phenyl-4-[4-(4-phenylphenyl)phenyl]-6-[4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-adamantyl]phenyl]-1,3,5-triazine.
| Compound Name | 2-phenyl-4-[4-(4-phenylphenyl)phenyl]-6-[4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-adamantyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 176628553 |
| Molecular Formula | C55H52BN3O2 |
| Molecular Weight | 797.85 g/mol |
| Exact Mass | 797.42 |
| IUPAC Name | 2-phenyl-4-[4-(4-phenylphenyl)phenyl]-6-[4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-adamantyl]phenyl]-1,3,5-triazine |
| SMILES | CC1(C)OB(c2ccc(C3(c4ccc(-c5nc(-c6ccccc6)nc(-c6ccc(-c7ccc(-c8ccccc8)cc7)cc6)n5)cc4)C4CC5CC(C4)CC3C5)cc2)OC1(C)C |
| InChI | InChI=1S/C55H52BN3O2/c1-53(2)54(3,4)61-56(60-53)49-29-27-46(28-30-49)55(47-32-36-31-37(34-47)35-48(55)33-36)45-25-23-44(24-26-45)52-58-50(42-13-9-6-10-14-42)57-51(59-52)43-21-19-41(20-22-43)40-17-15-39(16-18-40)38-11-7-5-8-12-38/h5-30,36-37,47-48H,31-35H2,1-4H3 |
| InChIKey | JISIUPVRQAMJMC-UHFFFAOYSA-N |
| XLogP | 12.25 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.85 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|