C47H46BN3O2 — CID 168808134
2-[4-[4-(1-adamantyl)phenyl]phenyl]-4-phenyl-6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1,3,5-triazine (PubChem CID 168808134) has the molecular formula C47H46BN3O2 and a molecular weight of 695.72 g/mol. Its IUPAC name is 2-[4-[4-(1-adamantyl)phenyl]phenyl]-4-phenyl-6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1,3,5-triazine.
| Compound Name | 2-[4-[4-(1-adamantyl)phenyl]phenyl]-4-phenyl-6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 168808134 |
| Molecular Formula | C47H46BN3O2 |
| Molecular Weight | 695.72 g/mol |
| Exact Mass | 695.37 |
| IUPAC Name | 2-[4-[4-(1-adamantyl)phenyl]phenyl]-4-phenyl-6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1,3,5-triazine |
| SMILES | CC1(C)OB(c2ccc3cc(-c4nc(-c5ccccc5)nc(-c5ccc(-c6ccc(C78CC9CC(CC(C9)C7)C8)cc6)cc5)n4)ccc3c2)OC1(C)C |
| InChI | InChI=1S/C47H46BN3O2/c1-45(2)46(3,4)53-48(52-45)41-21-18-37-25-39(15-14-38(37)26-41)44-50-42(35-8-6-5-7-9-35)49-43(51-44)36-12-10-33(11-13-36)34-16-19-40(20-17-34)47-27-30-22-31(28-47)24-32(23-30)29-47/h5-21,25-26,30-32H,22-24,27-29H2,1-4H3 |
| InChIKey | KPPUWVSAAGPSBI-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.72 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|